C16H14N2O4S — CID 10782638
3-(6-nitrospiro[1,2-dihydroindene-3,2'-1,3-dioxolane]-5-yl)sulfanylpyridine (PubChem CID 10782638) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is 3-(6-nitrospiro[1,2-dihydroindene-3,2'-1,3-dioxolane]-5-yl)sulfanylpyridine.
| Compound Name | 3-(6-nitrospiro[1,2-dihydroindene-3,2'-1,3-dioxolane]-5-yl)sulfanylpyridine |
|---|---|
| PubChem CID | 10782638 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 3-(6-nitrospiro[1,2-dihydroindene-3,2'-1,3-dioxolane]-5-yl)sulfanylpyridine |
| SMILES | O=[N+]([O-])c1cc2c(cc1Sc1cccnc1)C1(CC2)OCCO1 |
| InChI | InChI=1S/C16H14N2O4S/c19-18(20)14-8-11-3-4-16(21-6-7-22-16)13(11)9-15(14)23-12-2-1-5-17-10-12/h1-2,5,8-10H,3-4,6-7H2 |
| InChIKey | BVYSTLILMZOMBF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|