C12H23N3O5 — CID 107826744
(2R)-2-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-4-hydroxybutanoic acid (PubChem CID 107826744) has the molecular formula C12H23N3O5 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2R)-2-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107826744 |
| Molecular Formula | C12H23N3O5 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | (2R)-2-[[[2-(diethylamino)-2-oxoethyl]-methylcarbamoyl]amino]-4-hydroxybutanoic acid |
| SMILES | CCN(CC)C(=O)CN(C)C(=O)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C12H23N3O5/c1-4-15(5-2)10(17)8-14(3)12(20)13-9(6-7-16)11(18)19/h9,16H,4-8H2,1-3H3,(H,13,20)(H,18,19)/t9-/m1/s1 |
| InChIKey | ZWLMWKRMSUMHHP-SECBINFHSA-N |
| XLogP | -0.67 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |