C13H16ClN3O4 — CID 107826878
(2R)-4-amino-2-[1-(3-chlorophenyl)ethylcarbamoylamino]-4-oxobutanoic acid (PubChem CID 107826878) has the molecular formula C13H16ClN3O4 and a molecular weight of 313.74 g/mol. Its IUPAC name is (2R)-4-amino-2-[1-(3-chlorophenyl)ethylcarbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[1-(3-chlorophenyl)ethylcarbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107826878 |
| Molecular Formula | C13H16ClN3O4 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (2R)-4-amino-2-[1-(3-chlorophenyl)ethylcarbamoylamino]-4-oxobutanoic acid |
| SMILES | CC(NC(=O)N[C@H](CC(N)=O)C(=O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H16ClN3O4/c1-7(8-3-2-4-9(14)5-8)16-13(21)17-10(12(19)20)6-11(15)18/h2-5,7,10H,6H2,1H3,(H2,15,18)(H,19,20)(H2,16,17,21)/t7?,10-/m1/s1 |
| InChIKey | AVNXLNIGNNVVJK-OMNKOJBGSA-N |
| XLogP | 1.03 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |