C12H24N4O4 — CID 107827361
(2R)-4-amino-2-[1-(diethylamino)propan-2-ylcarbamoylamino]-4-oxobutanoic acid (PubChem CID 107827361) has the molecular formula C12H24N4O4 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2R)-4-amino-2-[1-(diethylamino)propan-2-ylcarbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[1-(diethylamino)propan-2-ylcarbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107827361 |
| Molecular Formula | C12H24N4O4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2R)-4-amino-2-[1-(diethylamino)propan-2-ylcarbamoylamino]-4-oxobutanoic acid |
| SMILES | CCN(CC)CC(C)NC(=O)N[C@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H24N4O4/c1-4-16(5-2)7-8(3)14-12(20)15-9(11(18)19)6-10(13)17/h8-9H,4-7H2,1-3H3,(H2,13,17)(H,18,19)(H2,14,15,20)/t8?,9-/m1/s1 |
| InChIKey | HDBBHQYPOQHVBU-YGPZHTELSA-N |
| XLogP | -0.66 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |