C13H17N3O5 — CID 107827374
(2R)-4-amino-2-[[(4-methoxyphenyl)-methylcarbamoyl]amino]-4-oxobutanoic acid (PubChem CID 107827374) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is (2R)-4-amino-2-[[(4-methoxyphenyl)-methylcarbamoyl]amino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-[[(4-methoxyphenyl)-methylcarbamoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107827374 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (2R)-4-amino-2-[[(4-methoxyphenyl)-methylcarbamoyl]amino]-4-oxobutanoic acid |
| SMILES | COc1ccc(N(C)C(=O)N[C@H](CC(N)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C13H17N3O5/c1-16(8-3-5-9(21-2)6-4-8)13(20)15-10(12(18)19)7-11(14)17/h3-6,10H,7H2,1-2H3,(H2,14,17)(H,15,20)(H,18,19)/t10-/m1/s1 |
| InChIKey | ZDHWTFFZNJPTNF-SNVBAGLBSA-N |
| XLogP | 0.17 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |