C12H13N3O4S — CID 10782760
N-(diaminomethylidene)-6-methyl-1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxamide (PubChem CID 10782760) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is N-(diaminomethylidene)-6-methyl-1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxamide.
| Compound Name | N-(diaminomethylidene)-6-methyl-1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxamide |
|---|---|
| PubChem CID | 10782760 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(diaminomethylidene)-6-methyl-1,1,4-trioxo-2,3-dihydrothiochromene-7-carboxamide |
| SMILES | Cc1cc2c(cc1C(=O)N=C(N)N)S(=O)(=O)CCC2=O |
| InChI | InChI=1S/C12H13N3O4S/c1-6-4-8-9(16)2-3-20(18,19)10(8)5-7(6)11(17)15-12(13)14/h4-5H,2-3H2,1H3,(H4,13,14,15,17) |
| InChIKey | DEMCMQJLZKGEPJ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|