About [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate
[2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate (PubChem CID 10782786) has the molecular formula C16H12O6S
and a molecular weight of 332.33 g/mol. Its IUPAC name is [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate.
Molecular Properties
| Compound Name | [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate |
| PubChem CID | 10782786 |
| Molecular Formula | C16H12O6S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)c1cccc2c1S(=O)(=O)c1ccccc1O2 |
| InChI | InChI=1S/C16H12O6S/c1-10(17)21-9-12(18)11-5-4-7-14-16(11)23(19,20)15-8-3-2-6-13(15)22-14/h2-8H,9H2,1H3 |
| InChIKey | YCHQMPQJEKHQKU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate?
The IUPAC name of [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate (CID 10782786) is [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate.
What is the SMILES notation for [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate?
The canonical SMILES for [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate is CC(=O)OCC(=O)c1cccc2c1S(=O)(=O)c1ccccc1O2.
What is the InChIKey of [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate?
The InChIKey is YCHQMPQJEKHQKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O6S/c1-10(17)21-9-12(18)11-5-4-7-14-16(11)23(19,20)15-8-3-2-6-13(15)22-14/h2-8H,9H2,1H3.
What are the key properties of [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate?
[2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate has a molecular weight of 332.33 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(10,10-dioxophenoxathiin-1-yl)-2-oxoethyl] acetate is sourced from PubChem (CID 10782786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).