C23H24O2 — CID 10782813
[(1S,2R,3S,4S,6R,7S)-2,4-dimethyl-1,7-diphenyl-3-tricyclo[2.2.1.02,6]heptanyl] acetate (PubChem CID 10782813) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7S)-2,4-dimethyl-1,7-diphenyl-3-tricyclo[2.2.1.02,6]heptanyl] acetate.
| Compound Name | [(1S,2R,3S,4S,6R,7S)-2,4-dimethyl-1,7-diphenyl-3-tricyclo[2.2.1.02,6]heptanyl] acetate |
|---|---|
| PubChem CID | 10782813 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7S)-2,4-dimethyl-1,7-diphenyl-3-tricyclo[2.2.1.02,6]heptanyl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@]2(C)C[C@H]3[C@]1(C)[C@]3(c1ccccc1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C23H24O2/c1-15(24)25-20-21(2)14-18-22(20,3)23(18,17-12-8-5-9-13-17)19(21)16-10-6-4-7-11-16/h4-13,18-20H,14H2,1-3H3/t18-,19+,20-,21-,22-,23-/m0/s1 |
| InChIKey | KDYDCEGXQUSAMS-ZKPZVSKHSA-N |
| XLogP | 4.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |