C21H19NO3 — CID 10782866
1,2-diphenyl-2-azaspiro[4.5]decane-3,4,6-trione (PubChem CID 10782866) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 1,2-diphenyl-2-azaspiro[4.5]decane-3,4,6-trione.
| Compound Name | 1,2-diphenyl-2-azaspiro[4.5]decane-3,4,6-trione |
|---|---|
| PubChem CID | 10782866 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1,2-diphenyl-2-azaspiro[4.5]decane-3,4,6-trione |
| SMILES | O=C1C(=O)C2(CCCCC2=O)C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C21H19NO3/c23-17-13-7-8-14-21(17)18(15-9-3-1-4-10-15)22(20(25)19(21)24)16-11-5-2-6-12-16/h1-6,9-12,18H,7-8,13-14H2 |
| InChIKey | XRWCZNIMXLSGOV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|