About 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine
4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine (PubChem CID 10782871) has the molecular formula C23H15N3
and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine |
| PubChem CID | 10782871 |
| Molecular Formula | C23H15N3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine |
| SMILES | C#Cc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C23H15N3/c1-2-17-9-11-18(12-10-17)19-15-22(20-7-3-5-13-24-20)26-23(16-19)21-8-4-6-14-25-21/h1,3-16H |
| InChIKey | JXMWREDYBWLMNY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine?
The IUPAC name of 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine (CID 10782871) is 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine.
What is the SMILES notation for 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine?
The canonical SMILES for 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine is C#Cc1ccc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc1.
What is the InChIKey of 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine?
The InChIKey is JXMWREDYBWLMNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15N3/c1-2-17-9-11-18(12-10-17)19-15-22(20-7-3-5-13-24-20)26-23(16-19)21-8-4-6-14-25-21/h1,3-16H.
What are the key properties of 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine?
4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine has a molecular weight of 333.39 g/mol, XLogP of 4.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethynylphenyl)-2,6-dipyridin-2-ylpyridine is sourced from PubChem (CID 10782871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).