C13H15N3O5 — CID 107828943
(2S)-2-[(4-cyano-2-methoxyphenyl)carbamoylamino]-4-hydroxybutanoic acid (PubChem CID 107828943) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is (2S)-2-[(4-cyano-2-methoxyphenyl)carbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(4-cyano-2-methoxyphenyl)carbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107828943 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (2S)-2-[(4-cyano-2-methoxyphenyl)carbamoylamino]-4-hydroxybutanoic acid |
| SMILES | COc1cc(C#N)ccc1NC(=O)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C13H15N3O5/c1-21-11-6-8(7-14)2-3-9(11)15-13(20)16-10(4-5-17)12(18)19/h2-3,6,10,17H,4-5H2,1H3,(H,18,19)(H2,15,16,20)/t10-/m0/s1 |
| InChIKey | MKSLBDGWJQJUBR-JTQLQIEISA-N |
| XLogP | 0.52 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |