C12H20N2O6S — CID 107829057
(2S)-5-methoxy-5-oxo-2-[(1-oxothian-4-yl)carbamoylamino]pentanoic acid (PubChem CID 107829057) has the molecular formula C12H20N2O6S and a molecular weight of 320.37 g/mol. Its IUPAC name is (2S)-5-methoxy-5-oxo-2-[(1-oxothian-4-yl)carbamoylamino]pentanoic acid.
| Compound Name | (2S)-5-methoxy-5-oxo-2-[(1-oxothian-4-yl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107829057 |
| Molecular Formula | C12H20N2O6S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (2S)-5-methoxy-5-oxo-2-[(1-oxothian-4-yl)carbamoylamino]pentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)NC1CCS(=O)CC1)C(=O)O |
| InChI | InChI=1S/C12H20N2O6S/c1-20-10(15)3-2-9(11(16)17)14-12(18)13-8-4-6-21(19)7-5-8/h8-9H,2-7H2,1H3,(H,16,17)(H2,13,14,18)/t8?,9-,21?/m0/s1 |
| InChIKey | RKDVAWGTDBSYFO-VOXJQSTESA-N |
| XLogP | -0.40 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |