C13H22N2O6 — CID 107829261
(2S)-5-methoxy-5-oxo-2-[1-(oxolan-3-yl)ethylcarbamoylamino]pentanoic acid (PubChem CID 107829261) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2S)-5-methoxy-5-oxo-2-[1-(oxolan-3-yl)ethylcarbamoylamino]pentanoic acid.
| Compound Name | (2S)-5-methoxy-5-oxo-2-[1-(oxolan-3-yl)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107829261 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2S)-5-methoxy-5-oxo-2-[1-(oxolan-3-yl)ethylcarbamoylamino]pentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)NC(C)C1CCOC1)C(=O)O |
| InChI | InChI=1S/C13H22N2O6/c1-8(9-5-6-21-7-9)14-13(19)15-10(12(17)18)3-4-11(16)20-2/h8-10H,3-7H2,1-2H3,(H,17,18)(H2,14,15,19)/t8?,9?,10-/m0/s1 |
| InChIKey | GGFOFVFOCIJYBX-RTBKNWGFSA-N |
| XLogP | 0.12 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |