C12H20N2O7 — CID 107829269
(2S)-2-[[3-(hydroxymethyl)morpholine-4-carbonyl]amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107829269) has the molecular formula C12H20N2O7 and a molecular weight of 304.30 g/mol. Its IUPAC name is (2S)-2-[[3-(hydroxymethyl)morpholine-4-carbonyl]amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[[3-(hydroxymethyl)morpholine-4-carbonyl]amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107829269 |
| Molecular Formula | C12H20N2O7 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (2S)-2-[[3-(hydroxymethyl)morpholine-4-carbonyl]amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)N1CCOCC1CO)C(=O)O |
| InChI | InChI=1S/C12H20N2O7/c1-20-10(16)3-2-9(11(17)18)13-12(19)14-4-5-21-7-8(14)6-15/h8-9,15H,2-7H2,1H3,(H,13,19)(H,17,18)/t8?,9-/m0/s1 |
| InChIKey | YIULVKIGGBXXOR-GKAPJAKFSA-N |
| XLogP | -1.20 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |