About (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid
(2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid (PubChem CID 107830015) has the molecular formula C11H14N4O6
and a molecular weight of 298.25 g/mol. Its IUPAC name is (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid.
Molecular Properties
| Compound Name | (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid |
| PubChem CID | 107830015 |
| Molecular Formula | C11H14N4O6 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@@H](NC(=O)Cn1[nH]c(=O)ccc1=O)C(=O)O |
| InChI | InChI=1S/C11H14N4O6/c12-7(16)2-1-6(11(20)21)13-9(18)5-15-10(19)4-3-8(17)14-15/h3-4,6H,1-2,5H2,(H2,12,16)(H,13,18)(H,14,17)(H,20,21)/t6-/m1/s1 |
| InChIKey | OIXHGNZVRZOMDS-ZCFIWIBFSA-N |
| XLogP | -2.63 |
| TPSA | 164.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid?
The IUPAC name of (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid (CID 107830015) is (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid.
What is the SMILES notation for (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid?
The canonical SMILES for (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid is NC(=O)CC[C@@H](NC(=O)Cn1[nH]c(=O)ccc1=O)C(=O)O.
What is the InChIKey of (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid?
The InChIKey is OIXHGNZVRZOMDS-ZCFIWIBFSA-N. The full InChI is InChI=1S/C11H14N4O6/c12-7(16)2-1-6(11(20)21)13-9(18)5-15-10(19)4-3-8(17)14-15/h3-4,6H,1-2,5H2,(H2,12,16)(H,13,18)(H,14,17)(H,20,21)/t6-/m1/s1.
What are the key properties of (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid?
(2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid has a molecular weight of 298.25 g/mol, XLogP of -2.63, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-amino-2-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]-5-oxopentanoic acid is sourced from PubChem (CID 107830015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).