C20H36O2Si — CID 10783117
(4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4a,7,7-tetramethyl-4,5,6,8-tetrahydro-3H-naphthalen-2-one (PubChem CID 10783117) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is (4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4a,7,7-tetramethyl-4,5,6,8-tetrahydro-3H-naphthalen-2-one.
| Compound Name | (4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4a,7,7-tetramethyl-4,5,6,8-tetrahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 10783117 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (4aS,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3,4a,7,7-tetramethyl-4,5,6,8-tetrahydro-3H-naphthalen-2-one |
| SMILES | CC1C[C@@]2(C)C(=CC1=O)CC(C)(C)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O2Si/c1-14-11-20(7)15(10-16(14)21)12-19(5,6)13-17(20)22-23(8,9)18(2,3)4/h10,14,17H,11-13H2,1-9H3/t14?,17-,20-/m0/s1 |
| InChIKey | HMUPMZMTPVNIDC-DRWNPLCXSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|