About 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol
5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol (PubChem CID 10783127) has the molecular formula C17H21BrO2
and a molecular weight of 337.26 g/mol. Its IUPAC name is 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol.
Molecular Properties
| Compound Name | 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol |
| PubChem CID | 10783127 |
| Molecular Formula | C17H21BrO2 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol |
| SMILES | C=C1C=CCC(C)(C)C1Cc1cc(OC)c(Br)cc1O |
| InChI | InChI=1S/C17H21BrO2/c1-11-6-5-7-17(2,3)13(11)8-12-9-16(20-4)14(18)10-15(12)19/h5-6,9-10,13,19H,1,7-8H2,2-4H3 |
| InChIKey | JNOHYAULZURALP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol?
The IUPAC name of 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol (CID 10783127) is 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol.
What is the SMILES notation for 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol?
The canonical SMILES for 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol is C=C1C=CCC(C)(C)C1Cc1cc(OC)c(Br)cc1O.
What is the InChIKey of 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol?
The InChIKey is JNOHYAULZURALP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21BrO2/c1-11-6-5-7-17(2,3)13(11)8-12-9-16(20-4)14(18)10-15(12)19/h5-6,9-10,13,19H,1,7-8H2,2-4H3.
What are the key properties of 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol?
5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol has a molecular weight of 337.26 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[(6,6-dimethyl-2-methylidenecyclohex-3-en-1-yl)methyl]-4-methoxyphenol is sourced from PubChem (CID 10783127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).