C11H11FN2O6 — CID 107831774
4-[(4-fluoro-3-nitrobenzoyl)amino]-2-hydroxybutanoic acid (PubChem CID 107831774) has the molecular formula C11H11FN2O6 and a molecular weight of 286.22 g/mol. Its IUPAC name is 4-[(4-fluoro-3-nitrobenzoyl)amino]-2-hydroxybutanoic acid.
| Compound Name | 4-[(4-fluoro-3-nitrobenzoyl)amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107831774 |
| Molecular Formula | C11H11FN2O6 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 4-[(4-fluoro-3-nitrobenzoyl)amino]-2-hydroxybutanoic acid |
| SMILES | O=C(NCCC(O)C(=O)O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11FN2O6/c12-7-2-1-6(5-8(7)14(19)20)10(16)13-4-3-9(15)11(17)18/h1-2,5,9,15H,3-4H2,(H,13,16)(H,17,18) |
| InChIKey | AYURSIXYCJAYIR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|