4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid

C13H16FNO5 — CID 107832248

IUPAC4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid
SMILESCC(Oc1ccccc1F)C(=O)NCCC(O)C(=O)O
InChIInChI=1S/C13H16FNO5/c1-8(20-11-5-3-2-4-9(11)14)12(17)15-7-6-10(16)13(18)19/h2-5,8,10,16H,6-7H2,1H3,(H,15,17)(H,18,19)
InChIKeyQWKDXYHDLTULDL-UHFFFAOYSA-N
MW285.27 g/mol
LogP0.54
Rot. Bonds7

About 4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid

4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid (PubChem CID 107832248) has the molecular formula C13H16FNO5 and a molecular weight of 285.27 g/mol. Its IUPAC name is 4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid.

Molecular Properties

Compound Name4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid
PubChem CID107832248
Molecular FormulaC13H16FNO5
Molecular Weight285.27 g/mol
Exact Mass285.10
IUPAC Name4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid
SMILESCC(Oc1ccccc1F)C(=O)NCCC(O)C(=O)O
InChIInChI=1S/C13H16FNO5/c1-8(20-11-5-3-2-4-9(11)14)12(17)15-7-6-10(16)13(18)19/h2-5,8,10,16H,6-7H2,1H3,(H,15,17)(H,18,19)
InChIKeyQWKDXYHDLTULDL-UHFFFAOYSA-N
XLogP0.54
TPSA95.86 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.27
LogP ≤ 50.54
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid?
The IUPAC name of 4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid (CID 107832248) is 4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid.
What is the SMILES notation for 4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid?
The canonical SMILES for 4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid is CC(Oc1ccccc1F)C(=O)NCCC(O)C(=O)O.
What is the InChIKey of 4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid?
The InChIKey is QWKDXYHDLTULDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO5/c1-8(20-11-5-3-2-4-9(11)14)12(17)15-7-6-10(16)13(18)19/h2-5,8,10,16H,6-7H2,1H3,(H,15,17)(H,18,19).
What are the key properties of 4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid?
4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid has a molecular weight of 285.27 g/mol, XLogP of 0.54, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-fluorophenoxy)propanoylamino]-2-hydroxybutanoic acid is sourced from PubChem (CID 107832248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).