C9H15NO5 — CID 107833848
(2S)-2-hydroxy-3-[[2-(oxolan-2-yl)acetyl]amino]propanoic acid (PubChem CID 107833848) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[[2-(oxolan-2-yl)acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-[[2-(oxolan-2-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 107833848 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (2S)-2-hydroxy-3-[[2-(oxolan-2-yl)acetyl]amino]propanoic acid |
| SMILES | O=C(CC1CCCO1)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C9H15NO5/c11-7(9(13)14)5-10-8(12)4-6-2-1-3-15-6/h6-7,11H,1-5H2,(H,10,12)(H,13,14)/t6?,7-/m0/s1 |
| InChIKey | ZCAUDSDLYFCHKW-MLWJPKLSSA-N |
| XLogP | -0.88 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |