C15H21NO5 — CID 107834348
(2S)-2-hydroxy-4-[4-(2-methylphenoxy)butanoylamino]butanoic acid (PubChem CID 107834348) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-[4-(2-methylphenoxy)butanoylamino]butanoic acid.
| Compound Name | (2S)-2-hydroxy-4-[4-(2-methylphenoxy)butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 107834348 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2S)-2-hydroxy-4-[4-(2-methylphenoxy)butanoylamino]butanoic acid |
| SMILES | Cc1ccccc1OCCCC(=O)NCC[C@H](O)C(=O)O |
| InChI | InChI=1S/C15H21NO5/c1-11-5-2-3-6-13(11)21-10-4-7-14(18)16-9-8-12(17)15(19)20/h2-3,5-6,12,17H,4,7-10H2,1H3,(H,16,18)(H,19,20)/t12-/m0/s1 |
| InChIKey | ZYBIWIMXJVYQDZ-LBPRGKRZSA-N |
| XLogP | 1.11 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|