C14H21NO4S — CID 107834625
(2S)-4-[(4-ethyl-5-propylthiophene-2-carbonyl)amino]-2-hydroxybutanoic acid (PubChem CID 107834625) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is (2S)-4-[(4-ethyl-5-propylthiophene-2-carbonyl)amino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[(4-ethyl-5-propylthiophene-2-carbonyl)amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107834625 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (2S)-4-[(4-ethyl-5-propylthiophene-2-carbonyl)amino]-2-hydroxybutanoic acid |
| SMILES | CCCc1sc(C(=O)NCC[C@H](O)C(=O)O)cc1CC |
| InChI | InChI=1S/C14H21NO4S/c1-3-5-11-9(4-2)8-12(20-11)13(17)15-7-6-10(16)14(18)19/h8,10,16H,3-7H2,1-2H3,(H,15,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | CYZYRLSCUMYAFI-JTQLQIEISA-N |
| XLogP | 1.83 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |