C12H15N3O5 — CID 107835532
(2R)-2-[(3-aminopyridine-2-carbonyl)amino]hexanedioic acid (PubChem CID 107835532) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is (2R)-2-[(3-aminopyridine-2-carbonyl)amino]hexanedioic acid.
| Compound Name | (2R)-2-[(3-aminopyridine-2-carbonyl)amino]hexanedioic acid |
|---|---|
| PubChem CID | 107835532 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (2R)-2-[(3-aminopyridine-2-carbonyl)amino]hexanedioic acid |
| SMILES | Nc1cccnc1C(=O)N[C@H](CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H15N3O5/c13-7-3-2-6-14-10(7)11(18)15-8(12(19)20)4-1-5-9(16)17/h2-3,6,8H,1,4-5,13H2,(H,15,18)(H,16,17)(H,19,20)/t8-/m1/s1 |
| InChIKey | OLHBFOGLLXJTGA-MRVPVSSYSA-N |
| XLogP | 0.10 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |