C19H25NO5 — CID 10783851
(1R,2S,6S,8R,9R,13R)-3-benzyl-8-methoxy-11,11-dimethyl-4,10,12,14-tetraoxa-3-azatetracyclo[6.6.0.02,6.09,13]tetradecane (PubChem CID 10783851) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is (1R,2S,6S,8R,9R,13R)-3-benzyl-8-methoxy-11,11-dimethyl-4,10,12,14-tetraoxa-3-azatetracyclo[6.6.0.02,6.09,13]tetradecane.
| Compound Name | (1R,2S,6S,8R,9R,13R)-3-benzyl-8-methoxy-11,11-dimethyl-4,10,12,14-tetraoxa-3-azatetracyclo[6.6.0.02,6.09,13]tetradecane |
|---|---|
| PubChem CID | 10783851 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (1R,2S,6S,8R,9R,13R)-3-benzyl-8-methoxy-11,11-dimethyl-4,10,12,14-tetraoxa-3-azatetracyclo[6.6.0.02,6.09,13]tetradecane |
| SMILES | CO[C@]12C[C@@H]3CON(Cc4ccccc4)[C@@H]3[C@H]1O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C19H25NO5/c1-18(2)24-16-17(25-18)23-15-14-13(9-19(15,16)21-3)11-22-20(14)10-12-7-5-4-6-8-12/h4-8,13-17H,9-11H2,1-3H3/t13-,14+,15-,16+,17-,19-/m1/s1 |
| InChIKey | BZWJMNAYSGSICY-PDDMAZILSA-N |
| XLogP | 2.08 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |