C13H21N3O5 — CID 107839191
(2R)-2-[[2-cyanopropyl(ethyl)carbamoyl]amino]hexanedioic acid (PubChem CID 107839191) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2R)-2-[[2-cyanopropyl(ethyl)carbamoyl]amino]hexanedioic acid.
| Compound Name | (2R)-2-[[2-cyanopropyl(ethyl)carbamoyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 107839191 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (2R)-2-[[2-cyanopropyl(ethyl)carbamoyl]amino]hexanedioic acid |
| SMILES | CCN(CC(C)C#N)C(=O)N[C@H](CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H21N3O5/c1-3-16(8-9(2)7-14)13(21)15-10(12(19)20)5-4-6-11(17)18/h9-10H,3-6,8H2,1-2H3,(H,15,21)(H,17,18)(H,19,20)/t9?,10-/m1/s1 |
| InChIKey | NPUKIELYGNFGHB-QVDQXJPCSA-N |
| XLogP | 0.89 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |