C27H24 — CID 10783954
(1S,2S,3R,18S,19R,20R)-21,22-dimethylideneheptacyclo[18.2.2.13,18.02,19.04,17.06,15.08,13]pentacosa-4,6,8,10,12,14,16-heptaene (PubChem CID 10783954) has the molecular formula C27H24 and a molecular weight of 348.49 g/mol. Its IUPAC name is (1S,2S,3R,18S,19R,20R)-21,22-dimethylideneheptacyclo[18.2.2.13,18.02,19.04,17.06,15.08,13]pentacosa-4,6,8,10,12,14,16-heptaene.
| Compound Name | (1S,2S,3R,18S,19R,20R)-21,22-dimethylideneheptacyclo[18.2.2.13,18.02,19.04,17.06,15.08,13]pentacosa-4,6,8,10,12,14,16-heptaene |
|---|---|
| PubChem CID | 10783954 |
| Molecular Formula | C27H24 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (1S,2S,3R,18S,19R,20R)-21,22-dimethylideneheptacyclo[18.2.2.13,18.02,19.04,17.06,15.08,13]pentacosa-4,6,8,10,12,14,16-heptaene |
| SMILES | C=C1C(=C)[C@@H]2CC[C@H]1[C@@H]1[C@H]2[C@@H]2C[C@H]1c1cc3cc4ccccc4cc3cc12 |
| InChI | InChI=1S/C27H24/c1-14-15(2)21-8-7-20(14)26-24-13-25(27(21)26)23-12-19-10-17-6-4-3-5-16(17)9-18(19)11-22(23)24/h3-6,9-12,20-21,24-27H,1-2,7-8,13H2/t20-,21+,24+,25-,26+,27- |
| InChIKey | ALCJQTQZNNGVNJ-HGLZPGAXSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|