C13H17ClN2O4 — CID 107839811
(2S)-3-[[1-(2-chlorophenyl)ethyl-methylcarbamoyl]amino]-2-hydroxypropanoic acid (PubChem CID 107839811) has the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. Its IUPAC name is (2S)-3-[[1-(2-chlorophenyl)ethyl-methylcarbamoyl]amino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[[1-(2-chlorophenyl)ethyl-methylcarbamoyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107839811 |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (2S)-3-[[1-(2-chlorophenyl)ethyl-methylcarbamoyl]amino]-2-hydroxypropanoic acid |
| SMILES | CC(c1ccccc1Cl)N(C)C(=O)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C13H17ClN2O4/c1-8(9-5-3-4-6-10(9)14)16(2)13(20)15-7-11(17)12(18)19/h3-6,8,11,17H,7H2,1-2H3,(H,15,20)(H,18,19)/t8?,11-/m0/s1 |
| InChIKey | MKZDIMFRQWHWDE-LYNSQETBSA-N |
| XLogP | 1.49 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |