C10H19N3O5 — CID 107840927
4-[[3-(ethylamino)-3-oxopropyl]carbamoylamino]-2-hydroxybutanoic acid (PubChem CID 107840927) has the molecular formula C10H19N3O5 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-[[3-(ethylamino)-3-oxopropyl]carbamoylamino]-2-hydroxybutanoic acid.
| Compound Name | 4-[[3-(ethylamino)-3-oxopropyl]carbamoylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107840927 |
| Molecular Formula | C10H19N3O5 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 4-[[3-(ethylamino)-3-oxopropyl]carbamoylamino]-2-hydroxybutanoic acid |
| SMILES | CCNC(=O)CCNC(=O)NCCC(O)C(=O)O |
| InChI | InChI=1S/C10H19N3O5/c1-2-11-8(15)4-6-13-10(18)12-5-3-7(14)9(16)17/h7,14H,2-6H2,1H3,(H,11,15)(H,16,17)(H2,12,13,18) |
| InChIKey | QWPBVYQBHQKRNT-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |