C21H22NO2P — CID 10784111
(2S,4S,5R)-3,4-dimethyl-2-(naphthalen-2-ylmethyl)-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide (PubChem CID 10784111) has the molecular formula C21H22NO2P and a molecular weight of 351.39 g/mol. Its IUPAC name is (2S,4S,5R)-3,4-dimethyl-2-(naphthalen-2-ylmethyl)-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide.
| Compound Name | (2S,4S,5R)-3,4-dimethyl-2-(naphthalen-2-ylmethyl)-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 10784111 |
| Molecular Formula | C21H22NO2P |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (2S,4S,5R)-3,4-dimethyl-2-(naphthalen-2-ylmethyl)-5-phenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
| SMILES | C[C@H]1[C@@H](c2ccccc2)O[P@@](=O)(Cc2ccc3ccccc3c2)N1C |
| InChI | InChI=1S/C21H22NO2P/c1-16-21(19-9-4-3-5-10-19)24-25(23,22(16)2)15-17-12-13-18-8-6-7-11-20(18)14-17/h3-14,16,21H,15H2,1-2H3/t16-,21-,25-/m0/s1 |
| InChIKey | YAKDHQIDXLUMHU-YVPSIOQSSA-N |
| XLogP | 5.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|