C9H8ClN3O2 — CID 107841937
3-(4-amino-3-chlorophenyl)imidazolidine-2,4-dione (PubChem CID 107841937) has the molecular formula C9H8ClN3O2 and a molecular weight of 225.64 g/mol. Its IUPAC name is 3-(4-amino-3-chlorophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-(4-amino-3-chlorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 107841937 |
| Molecular Formula | C9H8ClN3O2 |
| Molecular Weight | 225.64 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 3-(4-amino-3-chlorophenyl)imidazolidine-2,4-dione |
| SMILES | Nc1ccc(N2C(=O)CNC2=O)cc1Cl |
| InChI | InChI=1S/C9H8ClN3O2/c10-6-3-5(1-2-7(6)11)13-8(14)4-12-9(13)15/h1-3H,4,11H2,(H,12,15) |
| InChIKey | OORFUHCBKAHAOS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.64 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|