C23H32N2O — CID 10784222
2,4,6,7-tetramethyl-2-[(4-phenylbutylamino)methyl]-3H-1-benzofuran-5-amine (PubChem CID 10784222) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is 2,4,6,7-tetramethyl-2-[(4-phenylbutylamino)methyl]-3H-1-benzofuran-5-amine.
| Compound Name | 2,4,6,7-tetramethyl-2-[(4-phenylbutylamino)methyl]-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10784222 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 2,4,6,7-tetramethyl-2-[(4-phenylbutylamino)methyl]-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CNCCCCc1ccccc1)O2 |
| InChI | InChI=1S/C23H32N2O/c1-16-17(2)22-20(18(3)21(16)24)14-23(4,26-22)15-25-13-9-8-12-19-10-6-5-7-11-19/h5-7,10-11,25H,8-9,12-15,24H2,1-4H3 |
| InChIKey | TYRCEMWEJLDBAM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|