C18H14N2OSe — CID 10784245
5,7-diphenyl-5,7-dihydro-4H-1,2,3-benzoselenadiazol-6-one (PubChem CID 10784245) has the molecular formula C18H14N2OSe and a molecular weight of 353.28 g/mol. Its IUPAC name is 5,7-diphenyl-5,7-dihydro-4H-1,2,3-benzoselenadiazol-6-one.
| Compound Name | 5,7-diphenyl-5,7-dihydro-4H-1,2,3-benzoselenadiazol-6-one |
|---|---|
| PubChem CID | 10784245 |
| Molecular Formula | C18H14N2OSe |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 5,7-diphenyl-5,7-dihydro-4H-1,2,3-benzoselenadiazol-6-one |
| SMILES | O=C1C(c2ccccc2)Cc2nn[se]c2C1c1ccccc1 |
| InChI | InChI=1S/C18H14N2OSe/c21-17-14(12-7-3-1-4-8-12)11-15-18(22-20-19-15)16(17)13-9-5-2-6-10-13/h1-10,14,16H,11H2 |
| InChIKey | YZBOXVPCVLEUKJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|