C13H24N2O2 — CID 107842560
N-(6-hydroxyhexyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 107842560) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-(6-hydroxyhexyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 107842560 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-(6-hydroxyhexyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NCCCCCCO)C1CC2CCC1N2 |
| InChI | InChI=1S/C13H24N2O2/c16-8-4-2-1-3-7-14-13(17)11-9-10-5-6-12(11)15-10/h10-12,15-16H,1-9H2,(H,14,17) |
| InChIKey | PHSAKXDONXAPPH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|