C18H28N2O — CID 107842822
4-(2-aminoethyl)-N-(2,3-dihydro-1H-inden-2-yl)-5-methylhexanamide (PubChem CID 107842822) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-(2,3-dihydro-1H-inden-2-yl)-5-methylhexanamide.
| Compound Name | 4-(2-aminoethyl)-N-(2,3-dihydro-1H-inden-2-yl)-5-methylhexanamide |
|---|---|
| PubChem CID | 107842822 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 4-(2-aminoethyl)-N-(2,3-dihydro-1H-inden-2-yl)-5-methylhexanamide |
| SMILES | CC(C)C(CCN)CCC(=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H28N2O/c1-13(2)14(9-10-19)7-8-18(21)20-17-11-15-5-3-4-6-16(15)12-17/h3-6,13-14,17H,7-12,19H2,1-2H3,(H,20,21) |
| InChIKey | PRHYNTQIBXKSDD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |