About N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide
N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide (PubChem CID 10784284) has the molecular formula C19H32FNO2Si
and a molecular weight of 353.55 g/mol. Its IUPAC name is N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide.
Molecular Properties
| Compound Name | N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide |
| PubChem CID | 10784284 |
| Molecular Formula | C19H32FNO2Si |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide |
| SMILES | CC(F)(/C=[N+](\[O-])Cc1ccccc1)C(C)(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32FNO2Si/c1-17(2,3)24(7,8)23-18(4,5)19(6,20)15-21(22)14-16-12-10-9-11-13-16/h9-13,15H,14H2,1-8H3/b21-15- |
| InChIKey | QBRYVDIKQDKJTD-QNGOZBTKSA-N |
| XLogP | 5.30 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide?
The IUPAC name of N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide (CID 10784284) is N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide.
What is the SMILES notation for N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide?
The canonical SMILES for N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide is CC(F)(/C=[N+](\[O-])Cc1ccccc1)C(C)(C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide?
The InChIKey is QBRYVDIKQDKJTD-QNGOZBTKSA-N. The full InChI is InChI=1S/C19H32FNO2Si/c1-17(2,3)24(7,8)23-18(4,5)19(6,20)15-21(22)14-16-12-10-9-11-13-16/h9-13,15H,14H2,1-8H3/b21-15-.
What are the key properties of N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide?
N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide has a molecular weight of 353.55 g/mol, XLogP of 5.30, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-2-fluoro-2,3-dimethylbutan-1-imine oxide is sourced from PubChem (CID 10784284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).