C16H21N3O2 — CID 107843317
4-amino-1-ethyl-N-[2-(3-methoxyphenyl)ethyl]pyrrole-2-carboxamide (PubChem CID 107843317) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-[2-(3-methoxyphenyl)ethyl]pyrrole-2-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-[2-(3-methoxyphenyl)ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107843317 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-amino-1-ethyl-N-[2-(3-methoxyphenyl)ethyl]pyrrole-2-carboxamide |
| SMILES | CCn1cc(N)cc1C(=O)NCCc1cccc(OC)c1 |
| InChI | InChI=1S/C16H21N3O2/c1-3-19-11-13(17)10-15(19)16(20)18-8-7-12-5-4-6-14(9-12)21-2/h4-6,9-11H,3,7-8,17H2,1-2H3,(H,18,20) |
| InChIKey | RSUOYHNDWFIESJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |