C11H18BrN3 — CID 107845203
N'-(3-bromo-2-pyridinyl)hexane-1,6-diamine (PubChem CID 107845203) has the molecular formula C11H18BrN3 and a molecular weight of 272.19 g/mol. Its IUPAC name is N'-(3-bromo-2-pyridinyl)hexane-1,6-diamine.
| Compound Name | N'-(3-bromo-2-pyridinyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 107845203 |
| Molecular Formula | C11H18BrN3 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | N'-(3-bromo-2-pyridinyl)hexane-1,6-diamine |
| SMILES | NCCCCCCNc1ncccc1Br |
| InChI | InChI=1S/C11H18BrN3/c12-10-6-5-9-15-11(10)14-8-4-2-1-3-7-13/h5-6,9H,1-4,7-8,13H2,(H,14,15) |
| InChIKey | OZIGMCGKTXJBOB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|