C13H17N3O3 — CID 107845509
2-[(5-aminoquinolin-8-yl)amino]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 107845509) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-[(5-aminoquinolin-8-yl)amino]-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-[(5-aminoquinolin-8-yl)amino]-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 107845509 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-[(5-aminoquinolin-8-yl)amino]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | Nc1ccc(NC(CO)(CO)CO)c2ncccc12 |
| InChI | InChI=1S/C13H17N3O3/c14-10-3-4-11(12-9(10)2-1-5-15-12)16-13(6-17,7-18)8-19/h1-5,16-19H,6-8,14H2 |
| InChIKey | WMAFYNKITWFFOY-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|