C21H27NO4 — CID 10784563
tert-butyl 3-benzoyl-4-oxo-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 10784563) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl 3-benzoyl-4-oxo-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 3-benzoyl-4-oxo-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 10784563 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | tert-butyl 3-benzoyl-4-oxo-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(C(=O)c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C21H27NO4/c1-20(2,3)26-19(25)22-13-11-21(12-14-22)10-9-16(18(21)24)17(23)15-7-5-4-6-8-15/h4-8,16H,9-14H2,1-3H3 |
| InChIKey | QUKBXCTYGQDFDY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|