C21H21N5O — CID 10784697
5,6-dimethyl-2-(1-oxidopyridin-1-ium-4-yl)-7-[(1R)-1-phenylethyl]pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 10784697) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 5,6-dimethyl-2-(1-oxidopyridin-1-ium-4-yl)-7-[(1R)-1-phenylethyl]pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-2-(1-oxidopyridin-1-ium-4-yl)-7-[(1R)-1-phenylethyl]pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 10784697 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 5,6-dimethyl-2-(1-oxidopyridin-1-ium-4-yl)-7-[(1R)-1-phenylethyl]pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1c(C)n([C@H](C)c2ccccc2)c2nc(-c3cc[n+]([O-])cc3)nc(N)c12 |
| InChI | InChI=1S/C21H21N5O/c1-13-14(2)26(15(3)16-7-5-4-6-8-16)21-18(13)19(22)23-20(24-21)17-9-11-25(27)12-10-17/h4-12,15H,1-3H3,(H2,22,23,24)/t15-/m1/s1 |
| InChIKey | CMOMGRVEJGETFO-OAHLLOKOSA-N |
| XLogP | 3.54 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|