C13H21N4+ — CID 10784729
1-prop-2-ynyl-4,7,10-triaza-1-azoniatetracyclo[5.5.2.04,13.010,14]tetradecane (PubChem CID 10784729) has the molecular formula C13H21N4+ and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-prop-2-ynyl-4,7,10-triaza-1-azoniatetracyclo[5.5.2.04,13.010,14]tetradecane.
| Compound Name | 1-prop-2-ynyl-4,7,10-triaza-1-azoniatetracyclo[5.5.2.04,13.010,14]tetradecane |
|---|---|
| PubChem CID | 10784729 |
| Molecular Formula | C13H21N4+ |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-prop-2-ynyl-4,7,10-triaza-1-azoniatetracyclo[5.5.2.04,13.010,14]tetradecane |
| SMILES | C#CC[N+]12CCN3CCN4CCN(CC1)C2C43 |
| InChI | InChI=1S/C13H21N4/c1-2-9-17-10-7-15-4-3-14-5-6-16(8-11-17)13(17)12(14)15/h1,12-13H,3-11H2/q+1 |
| InChIKey | XTJIXGCXMRFNCQ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|