C15H20INO2 — CID 107848625
N-(6-iodohexyl)-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 107848625) has the molecular formula C15H20INO2 and a molecular weight of 373.23 g/mol. Its IUPAC name is N-(6-iodohexyl)-2,3-dihydro-1-benzofuran-5-carboxamide.
| Compound Name | N-(6-iodohexyl)-2,3-dihydro-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 107848625 |
| Molecular Formula | C15H20INO2 |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | N-(6-iodohexyl)-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | O=C(NCCCCCCI)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H20INO2/c16-8-3-1-2-4-9-17-15(18)13-5-6-14-12(11-13)7-10-19-14/h5-6,11H,1-4,7-10H2,(H,17,18) |
| InChIKey | JWVJMEWFZWJJNJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|