2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid

C22H22N2O3 — CID 10784875

IUPAC2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid
SMILESCCCCc1nccc(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1
InChIInChI=1S/C22H22N2O3/c1-2-3-8-20-23-14-13-21(25)24(20)15-16-9-11-17(12-10-16)18-6-4-5-7-19(18)22(26)27/h4-7,9-14H,2-3,8,15H2,1H3,(H,26,27)
InChIKeyPJZBQLZAHUCUQQ-UHFFFAOYSA-N
MW362.43 g/mol
LogP4.00
Rot. Bonds7

About 2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid

2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid (PubChem CID 10784875) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid.

Molecular Properties

Compound Name2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid
PubChem CID10784875
Molecular FormulaC22H22N2O3
Molecular Weight362.43 g/mol
Exact Mass362.16
IUPAC Name2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid
SMILESCCCCc1nccc(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1
InChIInChI=1S/C22H22N2O3/c1-2-3-8-20-23-14-13-21(25)24(20)15-16-9-11-17(12-10-16)18-6-4-5-7-19(18)22(26)27/h4-7,9-14H,2-3,8,15H2,1H3,(H,26,27)
InChIKeyPJZBQLZAHUCUQQ-UHFFFAOYSA-N
XLogP4.00
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms27
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500362.43
LogP ≤ 54.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid?
The IUPAC name of 2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid (CID 10784875) is 2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid.
What is the SMILES notation for 2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid?
The canonical SMILES for 2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid is CCCCc1nccc(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1.
What is the InChIKey of 2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid?
The InChIKey is PJZBQLZAHUCUQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O3/c1-2-3-8-20-23-14-13-21(25)24(20)15-16-9-11-17(12-10-16)18-6-4-5-7-19(18)22(26)27/h4-7,9-14H,2-3,8,15H2,1H3,(H,26,27).
What are the key properties of 2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid?
2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid has a molecular weight of 362.43 g/mol, XLogP of 4.00, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-butyl-6-oxopyrimidin-1-yl)methyl]phenyl]benzoic acid is sourced from PubChem (CID 10784875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).