C22H34O4 — CID 10784889
(4R)-4-[(4Z,5S,7aR)-5,7a-dimethyl-4-(2-oxoethylidene)-3-propan-2-yl-1,2,6,7-tetrahydroinden-5-yl]-4-(methoxymethoxy)butanal (PubChem CID 10784889) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (4R)-4-[(4Z,5S,7aR)-5,7a-dimethyl-4-(2-oxoethylidene)-3-propan-2-yl-1,2,6,7-tetrahydroinden-5-yl]-4-(methoxymethoxy)butanal.
| Compound Name | (4R)-4-[(4Z,5S,7aR)-5,7a-dimethyl-4-(2-oxoethylidene)-3-propan-2-yl-1,2,6,7-tetrahydroinden-5-yl]-4-(methoxymethoxy)butanal |
|---|---|
| PubChem CID | 10784889 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (4R)-4-[(4Z,5S,7aR)-5,7a-dimethyl-4-(2-oxoethylidene)-3-propan-2-yl-1,2,6,7-tetrahydroinden-5-yl]-4-(methoxymethoxy)butanal |
| SMILES | COCO[C@H](CCC=O)[C@@]1(C)CC[C@@]2(C)CCC(C(C)C)=C2/C1=C/C=O |
| InChI | InChI=1S/C22H34O4/c1-16(2)17-8-10-21(3)11-12-22(4,18(9-14-24)20(17)21)19(7-6-13-23)26-15-25-5/h9,13-14,16,19H,6-8,10-12,15H2,1-5H3/b18-9-/t19-,21-,22+/m1/s1 |
| InChIKey | SRKMOMOFIJEONC-YMTVLHHISA-N |
| XLogP | 4.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|