C10H13ClN2O5 — CID 107849238
2-(3-chloro-2-nitroanilino)-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 107849238) has the molecular formula C10H13ClN2O5 and a molecular weight of 276.68 g/mol. Its IUPAC name is 2-(3-chloro-2-nitroanilino)-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-(3-chloro-2-nitroanilino)-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 107849238 |
| Molecular Formula | C10H13ClN2O5 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-(3-chloro-2-nitroanilino)-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | O=[N+]([O-])c1c(Cl)cccc1NC(CO)(CO)CO |
| InChI | InChI=1S/C10H13ClN2O5/c11-7-2-1-3-8(9(7)13(17)18)12-10(4-14,5-15)6-16/h1-3,12,14-16H,4-6H2 |
| InChIKey | VIIDLEZFWVWRBX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|