C10H10F5NO3 — CID 107849369
2-(hydroxymethyl)-2-(2,3,4,5,6-pentafluoroanilino)propane-1,3-diol (PubChem CID 107849369) has the molecular formula C10H10F5NO3 and a molecular weight of 287.18 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(2,3,4,5,6-pentafluoroanilino)propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-(2,3,4,5,6-pentafluoroanilino)propane-1,3-diol |
|---|---|
| PubChem CID | 107849369 |
| Molecular Formula | C10H10F5NO3 |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-(hydroxymethyl)-2-(2,3,4,5,6-pentafluoroanilino)propane-1,3-diol |
| SMILES | OCC(CO)(CO)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H10F5NO3/c11-4-5(12)7(14)9(8(15)6(4)13)16-10(1-17,2-18)3-19/h16-19H,1-3H2 |
| InChIKey | CKIXFZSFILUYHT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|