C12H14N4O5 — CID 107849416
2-(hydroxymethyl)-2-[(6-nitroquinazolin-4-yl)amino]propane-1,3-diol (PubChem CID 107849416) has the molecular formula C12H14N4O5 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-[(6-nitroquinazolin-4-yl)amino]propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-[(6-nitroquinazolin-4-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 107849416 |
| Molecular Formula | C12H14N4O5 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-(hydroxymethyl)-2-[(6-nitroquinazolin-4-yl)amino]propane-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc2ncnc(NC(CO)(CO)CO)c2c1 |
| InChI | InChI=1S/C12H14N4O5/c17-4-12(5-18,6-19)15-11-9-3-8(16(20)21)1-2-10(9)13-7-14-11/h1-3,7,17-19H,4-6H2,(H,13,14,15) |
| InChIKey | YZCFZGDKRYLGJT-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 141.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|