C11H16N2O6 — CID 107849465
2-(hydroxymethyl)-2-(5-methoxy-2-nitroanilino)propane-1,3-diol (PubChem CID 107849465) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(5-methoxy-2-nitroanilino)propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-(5-methoxy-2-nitroanilino)propane-1,3-diol |
|---|---|
| PubChem CID | 107849465 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(hydroxymethyl)-2-(5-methoxy-2-nitroanilino)propane-1,3-diol |
| SMILES | COc1ccc([N+](=O)[O-])c(NC(CO)(CO)CO)c1 |
| InChI | InChI=1S/C11H16N2O6/c1-19-8-2-3-10(13(17)18)9(4-8)12-11(5-14,6-15)7-16/h2-4,12,14-16H,5-7H2,1H3 |
| InChIKey | YOFLWNVDFLCJSD-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|