About 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione
2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 107849819) has the molecular formula C12H19NO5
and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione.
Molecular Properties
| Compound Name | 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione |
| PubChem CID | 107849819 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C1CC2(CCCC2)C(=O)N1C(CO)(CO)CO |
| InChI | InChI=1S/C12H19NO5/c14-6-12(7-15,8-16)13-9(17)5-11(10(13)18)3-1-2-4-11/h14-16H,1-8H2 |
| InChIKey | GCDLIALNMKWQMT-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione?
The IUPAC name of 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione (CID 107849819) is 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione.
What is the SMILES notation for 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione?
The canonical SMILES for 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione is O=C1CC2(CCCC2)C(=O)N1C(CO)(CO)CO.
What is the InChIKey of 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione?
The InChIKey is GCDLIALNMKWQMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO5/c14-6-12(7-15,8-16)13-9(17)5-11(10(13)18)3-1-2-4-11/h14-16H,1-8H2.
What are the key properties of 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione?
2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione has a molecular weight of 257.29 g/mol, XLogP of -0.98, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2-azaspiro[4.4]nonane-1,3-dione is sourced from PubChem (CID 107849819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).