C17H14N2O2 — CID 107849976
3-(2,3-dihydro-1H-inden-2-yl)benzimidazole-4-carboxylic acid (PubChem CID 107849976) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-2-yl)benzimidazole-4-carboxylic acid.
| Compound Name | 3-(2,3-dihydro-1H-inden-2-yl)benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107849976 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-2-yl)benzimidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2ncn(C3Cc4ccccc4C3)c12 |
| InChI | InChI=1S/C17H14N2O2/c20-17(21)14-6-3-7-15-16(14)19(10-18-15)13-8-11-4-1-2-5-12(11)9-13/h1-7,10,13H,8-9H2,(H,20,21) |
| InChIKey | BWJGDJQWGJQVFK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |